C21H21N3O5 — CID 108823878
ethyl 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoate (PubChem CID 108823878) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is ethyl 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108823878 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)/C(C#N)=C\Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-4-29-21(26)14-5-7-16(8-6-14)24-20(25)15(12-22)13-23-17-9-10-18(27-2)19(11-17)28-3/h5-11,13,23H,4H2,1-3H3,(H,24,25)/b15-13- |
| InChIKey | HJIORFUFMADGEJ-SQFISAMPSA-N |
| XLogP | 3.34 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|