C16H19N3O5 — CID 108815266
ethyl 2-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]amino]acetate (PubChem CID 108815266) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is ethyl 2-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]amino]acetate.
| Compound Name | ethyl 2-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]amino]acetate |
|---|---|
| PubChem CID | 108815266 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | ethyl 2-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]amino]acetate |
| SMILES | CCOC(=O)CN/C=C(/C#N)C(=O)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H19N3O5/c1-4-24-15(20)10-18-9-11(8-17)16(21)19-12-5-6-13(22-2)14(7-12)23-3/h5-7,9,18H,4,10H2,1-3H3,(H,19,21)/b11-9- |
| InChIKey | MKVRBYRBJWFWRO-LUAWRHEFSA-N |
| XLogP | 1.20 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|