C24H21N3O4 — CID 108849513
(Z)-2-cyano-3-(3,4-dimethoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 108849513) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-dimethoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,4-dimethoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849513 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-dimethoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H21N3O4/c1-29-22-13-10-19(14-23(22)30-2)26-16-17(15-25)24(28)27-18-8-11-21(12-9-18)31-20-6-4-3-5-7-20/h3-14,16,26H,1-2H3,(H,27,28)/b17-16- |
| InChIKey | AXMUKVMGMGQCRS-MSUUIHNZSA-N |
| XLogP | 4.95 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|