C25H23N3O2 — CID 108849610
(Z)-2-cyano-N-(4-phenoxyphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide (PubChem CID 108849610) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-phenoxyphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-phenoxyphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108849610 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (Z)-2-cyano-N-(4-phenoxyphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide |
| SMILES | Cc1cc(C)c(N/C=C(/C#N)C(=O)Nc2ccc(Oc3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C25H23N3O2/c1-17-13-18(2)24(19(3)14-17)27-16-20(15-26)25(29)28-21-9-11-23(12-10-21)30-22-7-5-4-6-8-22/h4-14,16,27H,1-3H3,(H,28,29)/b20-16- |
| InChIKey | LKYVGVDGBYEGIB-SILNSSARSA-N |
| XLogP | 5.86 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|