C28H21N3O3 — CID 108849606
(Z)-2-cyano-3-(4-phenoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 108849606) has the molecular formula C28H21N3O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-phenoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-phenoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849606 |
| Molecular Formula | C28H21N3O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (Z)-2-cyano-3-(4-phenoxyanilino)-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(Oc2ccccc2)cc1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N3O3/c29-19-21(20-30-22-11-15-26(16-12-22)33-24-7-3-1-4-8-24)28(32)31-23-13-17-27(18-14-23)34-25-9-5-2-6-10-25/h1-18,20,30H,(H,31,32)/b21-20- |
| InChIKey | IOTXVDMOUIHRAY-MRCUWXFGSA-N |
| XLogP | 6.73 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|