C26H25N3O4 — CID 108849599
(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 108849599) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849599 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C(C)N/C=C(/C#N)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C26H25N3O4/c1-18(19-9-14-24(31-2)25(15-19)32-3)28-17-20(16-27)26(30)29-21-10-12-23(13-11-21)33-22-7-5-4-6-8-22/h4-15,17-18,28H,1-3H3,(H,29,30)/b20-17- |
| InChIKey | BYHUXQPZUBBALN-JZJYNLBNSA-N |
| XLogP | 5.19 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|