C15H16N6O — CID 108851244
(Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 108851244) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108851244 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C\Nc2ncn[nH]2)c(C)c1 |
| InChI | InChI=1S/C15H16N6O/c1-9-4-10(2)13(11(3)5-9)20-14(22)12(6-16)7-17-15-18-8-19-21-15/h4-5,7-8H,1-3H3,(H,20,22)(H2,17,18,19,21)/b12-7- |
| InChIKey | PJSXQXLROVDXLE-GHXNOFRVSA-N |
| XLogP | 2.19 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|