C10H14N6O — CID 108834527
(Z)-N-butan-2-yl-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108834527) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is (Z)-N-butan-2-yl-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-butan-2-yl-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108834527 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (Z)-N-butan-2-yl-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | CCC(C)NC(=O)/C(C#N)=C\Nc1ncn[nH]1 |
| InChI | InChI=1S/C10H14N6O/c1-3-7(2)15-9(17)8(4-11)5-12-10-13-6-14-16-10/h5-7H,3H2,1-2H3,(H,15,17)(H2,12,13,14,16)/b8-5- |
| InChIKey | JJLMLNNRRXEVFT-YVMONPNESA-N |
| XLogP | 0.54 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|