C14H14N6O2 — CID 108840848
(Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108840848) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is (Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108840848 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C(C#N)=C\Nc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C14H14N6O2/c1-22-12-4-2-10(3-5-12)7-16-13(21)11(6-15)8-17-14-18-9-19-20-14/h2-5,8-9H,7H2,1H3,(H,16,21)(H2,17,18,19,20)/b11-8- |
| InChIKey | WYNYSFKPASHYBI-FLIBITNWSA-N |
| XLogP | 0.95 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|