C9H15N3O — CID 108834487
(Z)-N-butan-2-yl-2-cyano-3-(methylamino)prop-2-enamide (PubChem CID 108834487) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (Z)-N-butan-2-yl-2-cyano-3-(methylamino)prop-2-enamide.
| Compound Name | (Z)-N-butan-2-yl-2-cyano-3-(methylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108834487 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (Z)-N-butan-2-yl-2-cyano-3-(methylamino)prop-2-enamide |
| SMILES | CCC(C)NC(=O)/C(C#N)=C\NC |
| InChI | InChI=1S/C9H15N3O/c1-4-7(2)12-9(13)8(5-10)6-11-3/h6-7,11H,4H2,1-3H3,(H,12,13)/b8-6- |
| InChIKey | IGJVAFUMEIIISK-VURMDHGXSA-N |
| XLogP | 0.53 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|