C13H18N4OS — CID 108834528
(Z)-N-butan-2-yl-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]prop-2-enamide (PubChem CID 108834528) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is (Z)-N-butan-2-yl-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-butan-2-yl-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108834528 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (Z)-N-butan-2-yl-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]prop-2-enamide |
| SMILES | CCC(C)NC(=O)/C(C#N)=C\Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C13H18N4OS/c1-5-8(2)16-12(18)11(6-14)7-15-13-17-9(3)10(4)19-13/h7-8H,5H2,1-4H3,(H,15,17)(H,16,18)/b11-7- |
| InChIKey | NVXYLHSGTITRKS-XFFZJAGNSA-N |
| XLogP | 2.49 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|