C16H16N4OS — CID 108821507
(Z)-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 108821507) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821507 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (Z)-2-cyano-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C16H16N4OS/c1-10-6-4-5-7-14(10)20-15(21)13(8-17)9-18-16-19-11(2)12(3)22-16/h4-7,9H,1-3H3,(H,18,19)(H,20,21)/b13-9- |
| InChIKey | QJVIGIQIISJQCL-LCYFTJDESA-N |
| XLogP | 3.53 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|