C19H27N3O — CID 108821467
(Z)-2-cyano-N-(2-methylphenyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide (PubChem CID 108821467) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-methylphenyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-methylphenyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108821467 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (Z)-2-cyano-N-(2-methylphenyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C19H27N3O/c1-14-9-7-8-10-16(14)22-17(23)15(11-20)12-21-19(5,6)13-18(2,3)4/h7-10,12,21H,13H2,1-6H3,(H,22,23)/b15-12- |
| InChIKey | LJZMSVNORQLUAV-QINSGFPZSA-N |
| XLogP | 4.15 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|