C19H27N3O — CID 108842268
(Z)-N-benzyl-2-cyano-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide (PubChem CID 108842268) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (Z)-N-benzyl-2-cyano-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-benzyl-2-cyano-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108842268 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (Z)-N-benzyl-2-cyano-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide |
| SMILES | CC(C)(C)CC(C)(C)N/C=C(/C#N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H27N3O/c1-18(2,3)14-19(4,5)22-13-16(11-20)17(23)21-12-15-9-7-6-8-10-15/h6-10,13,22H,12,14H2,1-5H3,(H,21,23)/b16-13- |
| InChIKey | MRCABUKQZIFHPG-SSZFMOIBSA-N |
| XLogP | 3.51 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|