C17H25N3O2 — CID 108863444
(Z)-2-cyano-N-(furan-2-ylmethyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide (PubChem CID 108863444) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (Z)-2-cyano-N-(furan-2-ylmethyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(furan-2-ylmethyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108863444 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (Z)-2-cyano-N-(furan-2-ylmethyl)-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enamide |
| SMILES | CC(C)(C)CC(C)(C)N/C=C(/C#N)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H25N3O2/c1-16(2,3)12-17(4,5)20-10-13(9-18)15(21)19-11-14-7-6-8-22-14/h6-8,10,20H,11-12H2,1-5H3,(H,19,21)/b13-10- |
| InChIKey | JEXKRUMFSQHYRT-RAXLEYEMSA-N |
| XLogP | 3.11 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|