C16H24N4O2 — CID 108863429
(Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 108863429) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863429 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CCN(CC)CCCN/C=C(/C#N)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H24N4O2/c1-3-20(4-2)9-6-8-18-12-14(11-17)16(21)19-13-15-7-5-10-22-15/h5,7,10,12,18H,3-4,6,8-9,13H2,1-2H3,(H,19,21)/b14-12- |
| InChIKey | CCCFFIBJQWWLMG-OWBHPGMISA-N |
| XLogP | 1.62 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|