C17H30N4O3 — CID 108845222
6-[[(Z)-2-cyano-3-[3-(diethylamino)propylamino]prop-2-enoyl]amino]hexanoic acid (PubChem CID 108845222) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 6-[[(Z)-2-cyano-3-[3-(diethylamino)propylamino]prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(Z)-2-cyano-3-[3-(diethylamino)propylamino]prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 108845222 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 6-[[(Z)-2-cyano-3-[3-(diethylamino)propylamino]prop-2-enoyl]amino]hexanoic acid |
| SMILES | CCN(CC)CCCN/C=C(/C#N)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C17H30N4O3/c1-3-21(4-2)12-8-10-19-14-15(13-18)17(24)20-11-7-5-6-9-16(22)23/h14,19H,3-12H2,1-2H3,(H,20,24)(H,22,23)/b15-14- |
| InChIKey | AIIYYELUVXHJDH-PFONDFGASA-N |
| XLogP | 1.48 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|