C14H22N4O4 — CID 108845300
6-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]hexanoic acid (PubChem CID 108845300) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 6-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 108845300 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 6-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]hexanoic acid |
| SMILES | CC(=O)NCCN/C=C(/C#N)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C14H22N4O4/c1-11(19)17-8-7-16-10-12(9-15)14(22)18-6-4-2-3-5-13(20)21/h10,16H,2-8H2,1H3,(H,17,19)(H,18,22)(H,20,21)/b12-10- |
| InChIKey | YGHPPZOCPMJJFE-BENRWUELSA-N |
| XLogP | -0.12 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|