C17H25N3O2 — CID 108863428
(Z)-2-cyano-3-(dibutylamino)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 108863428) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-(dibutylamino)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(dibutylamino)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863428 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (Z)-2-cyano-3-(dibutylamino)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CCCCN(/C=C(/C#N)C(=O)NCc1ccco1)CCCC |
| InChI | InChI=1S/C17H25N3O2/c1-3-5-9-20(10-6-4-2)14-15(12-18)17(21)19-13-16-8-7-11-22-16/h7-8,11,14H,3-6,9-10,13H2,1-2H3,(H,19,21)/b15-14- |
| InChIKey | XBXOTZHMWJQCSS-PFONDFGASA-N |
| XLogP | 3.21 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|