C19H13F6N3O — CID 108842312
(Z)-N-benzyl-3-[3,5-bis(trifluoromethyl)anilino]-2-cyanoprop-2-enamide (PubChem CID 108842312) has the molecular formula C19H13F6N3O and a molecular weight of 413.32 g/mol. Its IUPAC name is (Z)-N-benzyl-3-[3,5-bis(trifluoromethyl)anilino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-benzyl-3-[3,5-bis(trifluoromethyl)anilino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108842312 |
| Molecular Formula | C19H13F6N3O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (Z)-N-benzyl-3-[3,5-bis(trifluoromethyl)anilino]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H13F6N3O/c20-18(21,22)14-6-15(19(23,24)25)8-16(7-14)27-11-13(9-26)17(29)28-10-12-4-2-1-3-5-12/h1-8,11,27H,10H2,(H,28,29)/b13-11- |
| InChIKey | SWHUUFDVKAFMTL-QBFSEMIESA-N |
| XLogP | 4.86 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|