C19H21F6N3O2 — CID 108837131
(Z)-3-[3,5-bis(trifluoromethyl)anilino]-N-(3-butoxypropyl)-2-cyanoprop-2-enamide (PubChem CID 108837131) has the molecular formula C19H21F6N3O2 and a molecular weight of 437.38 g/mol. Its IUPAC name is (Z)-3-[3,5-bis(trifluoromethyl)anilino]-N-(3-butoxypropyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3,5-bis(trifluoromethyl)anilino]-N-(3-butoxypropyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108837131 |
| Molecular Formula | C19H21F6N3O2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (Z)-3-[3,5-bis(trifluoromethyl)anilino]-N-(3-butoxypropyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F6N3O2/c1-2-3-6-30-7-4-5-27-17(29)13(11-26)12-28-16-9-14(18(20,21)22)8-15(10-16)19(23,24)25/h8-10,12,28H,2-7H2,1H3,(H,27,29)/b13-12- |
| InChIKey | XYSPZRNGZOWYEI-SEYXRHQNSA-N |
| XLogP | 4.87 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|