C19H27N3O4 — CID 108837064
(Z)-N-(3-butoxypropyl)-2-cyano-3-(2,4-dimethoxyanilino)prop-2-enamide (PubChem CID 108837064) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (Z)-N-(3-butoxypropyl)-2-cyano-3-(2,4-dimethoxyanilino)prop-2-enamide.
| Compound Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-(2,4-dimethoxyanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108837064 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-(2,4-dimethoxyanilino)prop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H27N3O4/c1-4-5-10-26-11-6-9-21-19(23)15(13-20)14-22-17-8-7-16(24-2)12-18(17)25-3/h7-8,12,14,22H,4-6,9-11H2,1-3H3,(H,21,23)/b15-14- |
| InChIKey | HSLXWOPPGFTREZ-PFONDFGASA-N |
| XLogP | 2.85 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|