C19H25N3O4 — CID 108837213
methyl 3-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 108837213) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 3-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | methyl 3-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108837213 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | methyl 3-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\Nc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-4-10-26-11-6-9-21-18(23)16(13-20)14-22-17-8-5-7-15(12-17)19(24)25-2/h5,7-8,12,14,22H,3-4,6,9-11H2,1-2H3,(H,21,23)/b16-14- |
| InChIKey | SOGOICWCSDZBHR-PEZBUJJGSA-N |
| XLogP | 2.62 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|