C19H27N3O2 — CID 108837219
(Z)-N-(3-butoxypropyl)-2-cyano-3-[(3-methylphenyl)methylamino]prop-2-enamide (PubChem CID 108837219) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (Z)-N-(3-butoxypropyl)-2-cyano-3-[(3-methylphenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-[(3-methylphenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108837219 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-[(3-methylphenyl)methylamino]prop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\NCc1cccc(C)c1 |
| InChI | InChI=1S/C19H27N3O2/c1-3-4-10-24-11-6-9-22-19(23)18(13-20)15-21-14-17-8-5-7-16(2)12-17/h5,7-8,12,15,21H,3-4,6,9-11,14H2,1-2H3,(H,22,23)/b18-15- |
| InChIKey | NJJMFVQHUVKUPI-SDXDJHTJSA-N |
| XLogP | 2.82 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|