C21H27N3O6 — CID 108837069
dimethyl 2-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108837069) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is dimethyl 2-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108837069 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | dimethyl 2-[[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C21H27N3O6/c1-4-5-10-30-11-6-9-23-19(25)16(13-22)14-24-18-12-15(20(26)28-2)7-8-17(18)21(27)29-3/h7-8,12,14,24H,4-6,9-11H2,1-3H3,(H,23,25)/b16-14- |
| InChIKey | LSYIQJJGABEMLD-PEZBUJJGSA-N |
| XLogP | 2.40 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|