C22H20N4O6 — CID 108818651
dimethyl 2-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108818651) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is dimethyl 2-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108818651 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | dimethyl 2-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N/C=C(/C#N)C(=O)Nc2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C22H20N4O6/c1-13(27)25-16-5-7-17(8-6-16)26-20(28)15(11-23)12-24-19-10-14(21(29)31-2)4-9-18(19)22(30)32-3/h4-10,12,24H,1-3H3,(H,25,27)(H,26,28)/b15-12- |
| InChIKey | FIHDQIVVHCZLGW-QINSGFPZSA-N |
| XLogP | 2.68 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|