C18H14BrN3O3 — CID 108815785
methyl 2-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 108815785) has the molecular formula C18H14BrN3O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108815785 |
| Molecular Formula | C18H14BrN3O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | methyl 2-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N/C=C(/C#N)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrN3O3/c1-25-18(24)15-4-2-3-5-16(15)21-11-12(10-20)17(23)22-14-8-6-13(19)7-9-14/h2-9,11,21H,1H3,(H,22,23)/b12-11- |
| InChIKey | BTSCSSBFWJPSLN-QXMHVHEDSA-N |
| XLogP | 3.69 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|