C18H15BrClN3O3 — CID 108815962
(Z)-N-(4-bromophenyl)-3-(4-chloro-2,5-dimethoxyanilino)-2-cyanoprop-2-enamide (PubChem CID 108815962) has the molecular formula C18H15BrClN3O3 and a molecular weight of 436.69 g/mol. Its IUPAC name is (Z)-N-(4-bromophenyl)-3-(4-chloro-2,5-dimethoxyanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(4-bromophenyl)-3-(4-chloro-2,5-dimethoxyanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108815962 |
| Molecular Formula | C18H15BrClN3O3 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | (Z)-N-(4-bromophenyl)-3-(4-chloro-2,5-dimethoxyanilino)-2-cyanoprop-2-enamide |
| SMILES | COc1cc(N/C=C(/C#N)C(=O)Nc2ccc(Br)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H15BrClN3O3/c1-25-16-8-15(17(26-2)7-14(16)20)22-10-11(9-21)18(24)23-13-5-3-12(19)4-6-13/h3-8,10,22H,1-2H3,(H,23,24)/b11-10- |
| InChIKey | DHNMEFKPOCHNAI-KHPPLWFESA-N |
| XLogP | 4.58 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|