C19H18ClN3O2 — CID 108858750
(Z)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 108858750) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is (Z)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108858750 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (Z)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | COc1cc(Cl)c(C)cc1N/C=C(/C#N)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C19H18ClN3O2/c1-12-5-4-6-15(7-12)23-19(24)14(10-21)11-22-17-8-13(2)16(20)9-18(17)25-3/h4-9,11,22H,1-3H3,(H,23,24)/b14-11- |
| InChIKey | JQVDMHGWSSYPQB-KAMYIIQDSA-N |
| XLogP | 4.42 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|