C19H16ClN3O3 — CID 108856624
(Z)-N-(3-acetylphenyl)-3-(5-chloro-2-methoxyanilino)-2-cyanoprop-2-enamide (PubChem CID 108856624) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-3-(5-chloro-2-methoxyanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-3-(5-chloro-2-methoxyanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108856624 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-3-(5-chloro-2-methoxyanilino)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(Cl)cc1N/C=C(/C#N)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C19H16ClN3O3/c1-12(24)13-4-3-5-16(8-13)23-19(25)14(10-21)11-22-17-9-15(20)6-7-18(17)26-2/h3-9,11,22H,1-2H3,(H,23,25)/b14-11- |
| InChIKey | MSOGFYFPARVBIW-KAMYIIQDSA-N |
| XLogP | 4.01 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|