C18H13ClN4O2 — CID 108827636
(Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-cyanoanilino)prop-2-enamide (PubChem CID 108827636) has the molecular formula C18H13ClN4O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-cyanoanilino)prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-cyanoanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108827636 |
| Molecular Formula | C18H13ClN4O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-cyanoanilino)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C\Nc1ccccc1C#N |
| InChI | InChI=1S/C18H13ClN4O2/c1-25-17-7-6-14(19)8-16(17)23-18(24)13(10-21)11-22-15-5-3-2-4-12(15)9-20/h2-8,11,22H,1H3,(H,23,24)/b13-11- |
| InChIKey | XYLDDBIFYLEZJS-QBFSEMIESA-N |
| XLogP | 3.68 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|