C17H14Cl2N4O2 — CID 108827724
(Z)-3-(4-amino-2-chloroanilino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 108827724) has the molecular formula C17H14Cl2N4O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is (Z)-3-(4-amino-2-chloroanilino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2-chloroanilino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108827724 |
| Molecular Formula | C17H14Cl2N4O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (Z)-3-(4-amino-2-chloroanilino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C\Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N4O2/c1-25-16-5-2-11(18)6-15(16)23-17(24)10(8-20)9-22-14-4-3-12(21)7-13(14)19/h2-7,9,22H,21H2,1H3,(H,23,24)/b10-9- |
| InChIKey | QNBMOIDNVVRIQQ-KTKRTIGZSA-N |
| XLogP | 4.04 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|