C13H13Cl2N3O2 — CID 108827711
(Z)-3-(2-chloroethylamino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 108827711) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is (Z)-3-(2-chloroethylamino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(2-chloroethylamino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108827711 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (Z)-3-(2-chloroethylamino)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C\NCCCl |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-20-12-3-2-10(15)6-11(12)18-13(19)9(7-16)8-17-5-4-14/h2-3,6,8,17H,4-5H2,1H3,(H,18,19)/b9-8- |
| InChIKey | GLMMVXRSCNZSST-HJWRWDBZSA-N |
| XLogP | 2.52 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|