C17H14ClN5O4 — CID 108852606
(Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide (PubChem CID 108852606) has the molecular formula C17H14ClN5O4 and a molecular weight of 387.78 g/mol. Its IUPAC name is (Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108852606 |
| Molecular Formula | C17H14ClN5O4 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C(C#N)=C\Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C17H14ClN5O4/c1-27-16-7-12(23(25)26)3-5-15(16)22-17(24)10(8-19)9-21-14-4-2-11(20)6-13(14)18/h2-7,9,21H,20H2,1H3,(H,22,24)/b10-9- |
| InChIKey | ULSWMGBOTWRTCB-KTKRTIGZSA-N |
| XLogP | 3.30 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|