C19H18N4O4 — CID 108852659
(Z)-2-cyano-3-(3,4-dimethylanilino)-N-(2-methoxy-4-nitrophenyl)prop-2-enamide (PubChem CID 108852659) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-dimethylanilino)-N-(2-methoxy-4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,4-dimethylanilino)-N-(2-methoxy-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108852659 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-dimethylanilino)-N-(2-methoxy-4-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C(C#N)=C\Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H18N4O4/c1-12-4-5-15(8-13(12)2)21-11-14(10-20)19(24)22-17-7-6-16(23(25)26)9-18(17)27-3/h4-9,11,21H,1-3H3,(H,22,24)/b14-11- |
| InChIKey | VAFPMJHFJDRFQW-KAMYIIQDSA-N |
| XLogP | 3.68 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|