C18H13N5O4 — CID 108826587
(Z)-2-cyano-N-(2-cyanophenyl)-3-(2-methoxy-4-nitroanilino)prop-2-enamide (PubChem CID 108826587) has the molecular formula C18H13N5O4 and a molecular weight of 363.33 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-cyanophenyl)-3-(2-methoxy-4-nitroanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-cyanophenyl)-3-(2-methoxy-4-nitroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108826587 |
| Molecular Formula | C18H13N5O4 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (Z)-2-cyano-N-(2-cyanophenyl)-3-(2-methoxy-4-nitroanilino)prop-2-enamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1N/C=C(/C#N)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C18H13N5O4/c1-27-17-8-14(23(25)26)6-7-16(17)21-11-13(10-20)18(24)22-15-5-3-2-4-12(15)9-19/h2-8,11,21H,1H3,(H,22,24)/b13-11- |
| InChIKey | WHMFZQYLCOJUDF-QBFSEMIESA-N |
| XLogP | 2.93 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|