C17H15ClN4O4S — CID 108827677
(Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(4-sulfamoylanilino)prop-2-enamide (PubChem CID 108827677) has the molecular formula C17H15ClN4O4S and a molecular weight of 406.85 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(4-sulfamoylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(4-sulfamoylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108827677 |
| Molecular Formula | C17H15ClN4O4S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(4-sulfamoylanilino)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C\Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H15ClN4O4S/c1-26-16-7-2-12(18)8-15(16)22-17(23)11(9-19)10-21-13-3-5-14(6-4-13)27(20,24)25/h2-8,10,21H,1H3,(H,22,23)(H2,20,24,25)/b11-10- |
| InChIKey | XHEQDTRNPPWDHW-KHPPLWFESA-N |
| XLogP | 2.45 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|