C22H23N3O4 — CID 108828459
butyl 2-[[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 108828459) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108828459 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1N/C=C(/C#N)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-4-13-29-22(27)19-7-5-6-8-20(19)24-15-16(14-23)21(26)25-17-9-11-18(28-2)12-10-17/h5-12,15,24H,3-4,13H2,1-2H3,(H,25,26)/b16-15- |
| InChIKey | QEQKZLRDWWSLDD-NXVVXOECSA-N |
| XLogP | 4.11 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|