C23H25N3O3 — CID 108839980
butyl 2-[[(Z)-2-cyano-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]benzoate (PubChem CID 108839980) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108839980 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-oxo-3-(1-phenylethylamino)prop-1-enyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1N/C=C(/C#N)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c1-3-4-14-29-23(28)20-12-8-9-13-21(20)25-16-19(15-24)22(27)26-17(2)18-10-6-5-7-11-18/h5-13,16-17,25H,3-4,14H2,1-2H3,(H,26,27)/b19-16- |
| InChIKey | OYMWJBXFFRORMB-MNDPQUGUSA-N |
| XLogP | 4.34 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|