C19H23N3O4 — CID 108843656
butyl 2-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 108843656) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108843656 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1N/C=C(/C#N)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H23N3O4/c1-2-3-10-26-19(24)16-6-4-5-7-17(16)21-14-15(13-20)18(23)22-8-11-25-12-9-22/h4-7,14,21H,2-3,8-12H2,1H3/b15-14- |
| InChIKey | ZDZTZFBCSJUOPL-PFONDFGASA-N |
| XLogP | 2.32 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|