C25H28N4O4 — CID 108856056
butyl 2-[[(Z)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enoyl]amino]benzoate (PubChem CID 108856056) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108856056 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C25H28N4O4/c1-2-3-14-33-25(31)20-8-4-5-9-21(20)28-24(30)19(17-26)18-27-22-10-6-7-11-23(22)29-12-15-32-16-13-29/h4-11,18,27H,2-3,12-16H2,1H3,(H,28,30)/b19-18- |
| InChIKey | VZGTXWNLZUHBRC-HNENSFHCSA-N |
| XLogP | 3.94 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|