C20H20N4O3 — CID 108827444
(Z)-2-cyano-N-(4-hydroxyphenyl)-3-(2-morpholin-4-ylanilino)prop-2-enamide (PubChem CID 108827444) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-hydroxyphenyl)-3-(2-morpholin-4-ylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-hydroxyphenyl)-3-(2-morpholin-4-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108827444 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (Z)-2-cyano-N-(4-hydroxyphenyl)-3-(2-morpholin-4-ylanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1N1CCOCC1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H20N4O3/c21-13-15(20(26)23-16-5-7-17(25)8-6-16)14-22-18-3-1-2-4-19(18)24-9-11-27-12-10-24/h1-8,14,22,25H,9-12H2,(H,23,26)/b15-14- |
| InChIKey | RNZUQLAQDMNMJJ-PFONDFGASA-N |
| XLogP | 2.69 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|