C22H23N5O3 — CID 108818708
(Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enamide (PubChem CID 108818708) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is (Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enamide.
| Compound Name | (Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108818708 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(2-morpholin-4-ylanilino)prop-2-enamide |
| SMILES | CC(=O)N(C(=O)/C(C#N)=C\Nc1ccccc1N1CCOCC1)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H23N5O3/c1-16(28)27(19-8-6-18(24)7-9-19)22(29)17(14-23)15-25-20-4-2-3-5-21(20)26-10-12-30-13-11-26/h2-9,15,25H,10-13,24H2,1H3/b17-15- |
| InChIKey | ALHPKGCEPHZIHU-ICFOKQHNSA-N |
| XLogP | 2.50 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|