C20H22N4O4 — CID 108526488
N'-acetyl-N'-(3-aminophenyl)-N-(2-morpholin-4-ylphenyl)oxamide (PubChem CID 108526488) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N'-acetyl-N'-(3-aminophenyl)-N-(2-morpholin-4-ylphenyl)oxamide.
| Compound Name | N'-acetyl-N'-(3-aminophenyl)-N-(2-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108526488 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N'-acetyl-N'-(3-aminophenyl)-N-(2-morpholin-4-ylphenyl)oxamide |
| SMILES | CC(=O)N(C(=O)C(=O)Nc1ccccc1N1CCOCC1)c1cccc(N)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-14(25)24(16-6-4-5-15(21)13-16)20(27)19(26)22-17-7-2-3-8-18(17)23-9-11-28-12-10-23/h2-8,13H,9-12,21H2,1H3,(H,22,26) |
| InChIKey | VZDHYGLEWJYXIF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|