C18H27N3O5 — CID 108527466
N',N'-bis(2-methoxyethyl)-N-(2-morpholin-4-ylphenyl)oxamide (PubChem CID 108527466) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is N',N'-bis(2-methoxyethyl)-N-(2-morpholin-4-ylphenyl)oxamide.
| Compound Name | N',N'-bis(2-methoxyethyl)-N-(2-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108527466 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N',N'-bis(2-methoxyethyl)-N-(2-morpholin-4-ylphenyl)oxamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C18H27N3O5/c1-24-11-7-21(8-12-25-2)18(23)17(22)19-15-5-3-4-6-16(15)20-9-13-26-14-10-20/h3-6H,7-14H2,1-2H3,(H,19,22) |
| InChIKey | NLWDXEJTABAHKG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|