C22H22ClN5O5S — CID 108818578
(Z)-N-acetyl-N-(4-aminophenyl)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyanoprop-2-enamide (PubChem CID 108818578) has the molecular formula C22H22ClN5O5S and a molecular weight of 503.97 g/mol. Its IUPAC name is (Z)-N-acetyl-N-(4-aminophenyl)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-acetyl-N-(4-aminophenyl)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108818578 |
| Molecular Formula | C22H22ClN5O5S |
| Molecular Weight | 503.97 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | (Z)-N-acetyl-N-(4-aminophenyl)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyanoprop-2-enamide |
| SMILES | CC(=O)N(C(=O)/C(C#N)=C\Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H22ClN5O5S/c1-15(29)28(18-4-2-17(25)3-5-18)22(30)16(13-24)14-26-21-12-19(6-7-20(21)23)34(31,32)27-8-10-33-11-9-27/h2-7,12,14,26H,8-11,25H2,1H3/b16-14- |
| InChIKey | FZPYOEZOHLATGR-PEZBUJJGSA-N |
| XLogP | 2.34 |
| TPSA | 145.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.97 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|