C21H18ClN5O4S — CID 108826633
(Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2-cyanophenyl)prop-2-enamide (PubChem CID 108826633) has the molecular formula C21H18ClN5O4S and a molecular weight of 471.93 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2-cyanophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2-cyanophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108826633 |
| Molecular Formula | C21H18ClN5O4S |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2-cyanophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C21H18ClN5O4S/c22-18-6-5-17(32(29,30)27-7-9-31-10-8-27)11-20(18)25-14-16(13-24)21(28)26-19-4-2-1-3-15(19)12-23/h1-6,11,14,25H,7-10H2,(H,26,28)/b16-14- |
| InChIKey | UYXOYBMEHJULSK-PEZBUJJGSA-N |
| XLogP | 2.69 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|