C18H18ClN3O6S — CID 108514243
N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-(2-hydroxyphenyl)oxamide (PubChem CID 108514243) has the molecular formula C18H18ClN3O6S and a molecular weight of 439.88 g/mol. Its IUPAC name is N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-(2-hydroxyphenyl)oxamide.
| Compound Name | N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-(2-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 108514243 |
| Molecular Formula | C18H18ClN3O6S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-(2-hydroxyphenyl)oxamide |
| SMILES | O=C(Nc1ccccc1O)C(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O6S/c19-13-6-5-12(29(26,27)22-7-9-28-10-8-22)11-15(13)21-18(25)17(24)20-14-3-1-2-4-16(14)23/h1-6,11,23H,7-10H2,(H,20,24)(H,21,25) |
| InChIKey | AYXIUSPPMPCMAR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|