C17H22ClN3O4S — CID 108913571
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopentylidenemethyl)urea (PubChem CID 108913571) has the molecular formula C17H22ClN3O4S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopentylidenemethyl)urea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopentylidenemethyl)urea |
|---|---|
| PubChem CID | 108913571 |
| Molecular Formula | C17H22ClN3O4S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopentylidenemethyl)urea |
| SMILES | O=C(NC=C1CCCC1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C17H22ClN3O4S/c18-15-6-5-14(26(23,24)21-7-9-25-10-8-21)11-16(15)20-17(22)19-12-13-3-1-2-4-13/h5-6,11-12H,1-4,7-10H2,(H2,19,20,22) |
| InChIKey | FLCKOYQPJJKOJV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |