C19H21Cl2N3O4S — CID 108891884
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[2-(4-chlorophenyl)ethyl]urea (PubChem CID 108891884) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[2-(4-chlorophenyl)ethyl]urea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[2-(4-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108891884 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[2-(4-chlorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccc(Cl)cc1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O4S/c20-15-3-1-14(2-4-15)7-8-22-19(25)23-18-13-16(5-6-17(18)21)29(26,27)24-9-11-28-12-10-24/h1-6,13H,7-12H2,(H2,22,23,25) |
| InChIKey | VLDPAFNHTRFCJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |